Valine (data page)
From Wikipedia, the free encyclopedia
| The complete data for Valine | ||||||||||||||||
| General information Chemical formula: C5H11NO2
Molar mass: 117.15 g·mol-1 Systematic name: (S)-2-amino-3-methyl-butanoic acid Abbreviations: V, Val Synonyms: none |
||||||||||||||||
| Database data | ||||||||||||||||
| SMILES: CC(C)C(N)C(=O)O InChI=1/C5H11NO2/c1-3(2)4(6)5(7)8/h3-4H,6H2,1-2H3,(H,7,8)/f/h7H
|
||||||||||||||||
| Physical properties | ||||||||||||||||
|
||||||||||||||||
| Hazard properties | ||||||||||||||||
|
||||||||||||||||
| Chemical properties | ||||||||||||||||
|
||||||||||||||||
| Pharmacological properties | ||||||||||||||||
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) | ||||||||||||||||
[edit] References
|
||||||||

