Alanine (data page)
From Wikipedia, the free encyclopedia
| The complete data for Alanine | ||||||||||||||||
| General information Chemical formula: C3H7NO2
Molar mass: 89.1 g·mol-1 Systematic name: (S)-2-aminopropanoic acid Abbreviations: A, Ala Synonyms: 2-aminopropanoic acid {α/2}-aminopropionic acid AIDS{-}071780 HSDB 1801 NSC 206315 |
||||||||||||||||
| Database data | ||||||||||||||||
| SMILES: N[C@@]([H])(C)C(O)=O InChI=1/C3H7NO2/c1-2(4)3(5)6/h2H,4H2,1H3,(H,5,6)/f/h5H
|
||||||||||||||||
| Physical properties | ||||||||||||||||
|
||||||||||||||||
| Hazard properties | ||||||||||||||||
|
||||||||||||||||
| Chemical properties | ||||||||||||||||
|
||||||||||||||||
| Pharmacological properties | ||||||||||||||||
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) | ||||||||||||||||
[edit] References
|
||||||||

