Glycine (data page)
From Wikipedia, the free encyclopedia
| The complete data for Glycine | ||||||||||||||||
| General information Chemical formula: C2H5NO2
Molar mass: 75.067 g·mol-1 Systematic name: 2-aminoacetic acid Abbreviations: G, Gly Synonyms: Aciport Aminoacetic acid Aminoethanoic acid Amitone Corilin Glicoamin Glycocoll Glycolixir Glycosthene Glykokoll Glyzin Gyn-hydralin Hampshire glycine Hgly Padil Sucre de gelatine |
||||||||||||||||
| Database data | ||||||||||||||||
| SMILES: NCC(=O)O InChI=1/C2H5NO2/c3-1-2(4)5/h1,3H2,(H,4,5)/f/h4H [2]
|
||||||||||||||||
| Physical properties | ||||||||||||||||
|
||||||||||||||||
| Hazard properties | ||||||||||||||||
|
||||||||||||||||
| Chemical properties | ||||||||||||||||
|
||||||||||||||||
| Pharmacological properties | ||||||||||||||||
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) | ||||||||||||||||
[edit] References
|
||||||||

