Glutamic acid (data page)
From Wikipedia, the free encyclopedia
| The complete data for Glutamic acid | ||||||||||||||||
| General information Chemical formula: C5H9NO4
Molar mass: 147.13 g·mol-1 Systematic name: (2S)-2-aminopentanedioic acid Abbreviations: E, Glu Synonyms: 2-amino-glutaric acid Glutacid Glutaminic acid |
||||||||||||||||
| Database data | ||||||||||||||||
| SMILES: OC(=O)CCC(N)C(=O)O InChI=1/C5H9NO4/c6-3(5(9)10)1-2-4(7)8/h3H,1-2,6H2,(H,7,8)(H,9,10)/t3-/m0/s1/f/h7,9H - (L)
|
||||||||||||||||
| Physical properties | ||||||||||||||||
|
||||||||||||||||
| Hazard properties | ||||||||||||||||
|
||||||||||||||||
| Chemical properties | ||||||||||||||||
|
||||||||||||||||
| Pharmacological properties | ||||||||||||||||
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) | ||||||||||||||||
[edit] References
|
||||||||

