Cysteine (data page)
From Wikipedia, the free encyclopedia
| The complete data for Cysteine | ||||||||||||||||
| General information Chemical formula: C3H7NO2S
Molar mass: 121.16 g·mol-1 Systematic name: (2R)-2-amino-3-sulfanyl-propanoic acid Abbreviations: C, Cys Synonyms: 2-amino-3-mercaptopropanoic acid 2-amino-3-mercaptopropionic acid 2-amino-3-sulfanylpropanoic acid 3-mercaptoalanine AIDS{-}160777 CHEBI:15356 CHEMBANK2703 NSC 63864 NSC647530 NSC8746 Zystein |
||||||||||||||||
| Database data | ||||||||||||||||
| SMILES: SCC(N)C(=O)O InChI=1/C3H7NO2S/c4-2(1-7)3(5)6/h2,7H,1,4H2,(H,5,6)/f/h5H
|
||||||||||||||||
| Physical properties | ||||||||||||||||
|
||||||||||||||||
| Hazard properties | ||||||||||||||||
|
||||||||||||||||
| Chemical properties | ||||||||||||||||
|
||||||||||||||||
| Pharmacological properties | ||||||||||||||||
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) | ||||||||||||||||
[edit] References
- a []
|
||||||||

