Phenylalanine (data page)
From Wikipedia, the free encyclopedia
| The complete data for Phenylalanine | ||||||||||||||||
| General information Chemical formula: C9H11NO2
Molar mass: 165.19 g·mol-1 Systematic name: 2-Amino-3-phenyl-propanoic acid Abbreviations: F, Phe Synonyms: alpha-Amino-beta-phenylpropionic acid (2R)-2-amino-3- phenylpropanoic acid (2S)-2-amino-3-phenylpropanoic acid |
||||||||||||||||
| Database data | ||||||||||||||||
| SMILES: C1=CC=C(C=C1)CC(C(=O)O)N InChI=1/C9H11NO2/c10-8(9(11)12)6-7-4-2-1-3-5-7/h1-5,8H,6,10H2,(H,11,12)/t8-/m0/s1/f/h11H
|
||||||||||||||||
| Physical properties | ||||||||||||||||
|
||||||||||||||||
| Hazard properties | ||||||||||||||||
|
||||||||||||||||
| Chemical properties | ||||||||||||||||
|
||||||||||||||||
| Pharmacological properties | ||||||||||||||||
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) | ||||||||||||||||
[edit] References
- a EINECS number 200-568-1 (phenylalanine)
- a CID 994 from PubChem (phenylalanine)
- a CID 71567 from PubChem (D-phenylalanine)
- a CID 6140 from PubChem (L-phenylalanine)
|
|||||||||||

