Glutamine (data page)
From Wikipedia, the free encyclopedia
| The complete data for Glutamine | ||||||||||||||||
| General information Chemical formula: C5H10N2O3
Molar mass: 146.15 g·mol-1 Systematic name: (2S)-2-amino-4-carbamoyl-butanoic acid Abbreviations: Q, Gln Synonyms: {γ/+/-/D/L}-Glutamine 2-amino-4-carbamoylbutanoic acid {L-/D-}2-aminoglutaramic acid AI3-32686 C00303 Cebrogen G107 Glumin Glutamic acid {5-/γ-} amide {L-/D-}glutamid Miglu-P NSC 97925 NSC27421 |
||||||||||||||||
| Database data | ||||||||||||||||
| SMILES: NC(=O)CCC(N)C(=O)O InChI=1/C5H10N2O3/c6-3(5(9)10)1-2-4(7)8/h3H,1-2,6H2,(H2,7,8)(H,9,10)/f/h9H,7H2
|
||||||||||||||||
| Physical properties | ||||||||||||||||
|
||||||||||||||||
| Hazard properties | ||||||||||||||||
|
||||||||||||||||
| Chemical properties | ||||||||||||||||
|
||||||||||||||||
| Pharmacological properties | ||||||||||||||||
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) | ||||||||||||||||
[edit] References
|
||||||||

