Serine (data page)
From Wikipedia, the free encyclopedia
| The complete data for Serine | ||||||||||||||||
| General information Chemical formula: C3H7NO3
Molar mass: 105.09 g·mol-1 Systematic name: -2-amino-3-hydroxypropanoic acid Abbreviations: S, Ser Synonyms: none |
||||||||||||||||
| Database data | ||||||||||||||||
| SMILES: OCC(N)C(=O)O InChI=1/C3H7NO3/c4-2(1-5)3(6)7/h2,5H,1,4H2,(H,6,7)/f/h6H
|
||||||||||||||||
| Physical properties | ||||||||||||||||
|
||||||||||||||||
| Hazard properties | ||||||||||||||||
|
||||||||||||||||
| Chemical properties | ||||||||||||||||
|
||||||||||||||||
| Pharmacological properties | ||||||||||||||||
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) | ||||||||||||||||
[edit] References
|
||||||||

