Isoleucine (data page)
From Wikipedia, the free encyclopedia
| The complete data for Isoleucine | ||||||||||||||||
| General information Chemical formula: C6H13NO2
Molar mass: 131.18 [1] g·mol-1 Systematic name: (2S,3S)-2-amino-3-methylpentanoic acid Abbreviations: I, Ile Synonyms: {2/α}-amino-{3/β}-methylvaleric acid 3-methyl-{/erythro-}norvaline Amino-sec-butyl-acetic acid Amino(1-methylpropyl)-acetic acid |
||||||||||||||||
| Database data | ||||||||||||||||
| SMILES: CC[C@H](C)[C@@H](C(=O)O)N [1] InChI=1/C6H13NO2/c1-3-4(2)5(7)6(8)9/h4-5H,3,7H2,1-2H3,(H,8,9)/t4-,5-/m0/s1/f/h8H [1]
|
||||||||||||||||
| Physical properties | ||||||||||||||||
|
||||||||||||||||
| Hazard properties | ||||||||||||||||
|
||||||||||||||||
| Chemical properties | ||||||||||||||||
|
||||||||||||||||
| Pharmacological properties | ||||||||||||||||
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) | ||||||||||||||||
[edit] References
|
||||||||

