Methionine (data page)
From Wikipedia, the free encyclopedia
| The complete data for Methionine | ||||||||||||||||
| General information Chemical formula: C5H11NO2S
Molar mass: 149.21 g·mol-1 Systematic name: (S)2-amino-4-methylsulfanyl-butanoic acid Abbreviations: M, Met Synonyms: ? |
||||||||||||||||
| Database data | ||||||||||||||||
| SMILES: CSCCC(C(=O)O)N InChI=InChI=1/C5H11NO2S/c1-9-3-2-4(6)5(7)8/h4H,2-3,6H2,1H3,(H,7,8)/f/h7H (L) 1/C5H11NO2S/c1-9-3-2-4(6)5(7)8/h4H,2-3,6H2,1H3,(H,7,8)/t4-/m0/s1/f/h7H (D)
|
||||||||||||||||
| Physical properties | ||||||||||||||||
|
||||||||||||||||
| Hazard properties | ||||||||||||||||
|
||||||||||||||||
| Chemical properties | ||||||||||||||||
|
||||||||||||||||
| Pharmacological properties | ||||||||||||||||
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) | ||||||||||||||||
[edit] References
|
|||||||||||

