Tryptophan (data page)
From Wikipedia, the free encyclopedia
| The complete data for Tryptophan | ||||||||||||||||
| General information Chemical formula: C11H11N2O2
Molar mass: 204.23 g·mol-1 Systematic name: (S)-2-Amino-3-(1H-indol-3-yl)-propanoic acid Abbreviations: W, Trp Synonyms: none |
||||||||||||||||
| Database data | ||||||||||||||||
| SMILES: C(N)(C(=O)O)CC1c2ccccc2NC=1 InChI=1/C11H12N2O2/c12-9(11(14)15)5-7-6-13-10-4-2-1-3-8(7)10/h1-4,6,9,13H,5,12H2,(H,14,15)/t9-/m1/s1/f/h14H 1/C3H7NO2/c1-2(4)3(5)6/h2H,4H2,1H3,(H,5,6)/f/h5H
|
||||||||||||||||
| Physical properties | ||||||||||||||||
|
||||||||||||||||
| Hazard properties | ||||||||||||||||
|
||||||||||||||||
| Chemical properties | ||||||||||||||||
|
||||||||||||||||
| Pharmacological properties | ||||||||||||||||
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) | ||||||||||||||||
[edit] References
|
||||||||

