Tyrosine (data page)
From Wikipedia, the free encyclopedia
| The complete data for Tyrosine | ||||||||||||||||
| General information Chemical formula: C9H11NO3
Molar mass: 181.19 g·mol-1 Systematic name: (S)-2-Amino-3-(4-hydroxy-phenyl)-propanoic acid Abbreviations: Y, Tyr Synonyms: none |
||||||||||||||||
| Database data | ||||||||||||||||
| SMILES: Oc1ccc(CC(N)C(=O)O)cc1 InChI=1/C9H11NO3/c10-8(9(12)13)5-6-1-3-7(11)4-2-6/h1-4,8,11H,5,10H2,(H,12,13)/f/h12H
|
||||||||||||||||
| Physical properties | ||||||||||||||||
|
||||||||||||||||
| Hazard properties | ||||||||||||||||
|
||||||||||||||||
| Chemical properties | ||||||||||||||||
|
||||||||||||||||
| Pharmacological properties | ||||||||||||||||
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) | ||||||||||||||||
[edit] References
|
||||||||

