Threonine (data page)
From Wikipedia, the free encyclopedia
| The complete data for Threonine | ||||||||||||||||
| General information Chemical formula: C4H9NO3
Molar mass: 119.12 g·mol-1 Systematic name: (2S,3R)-2-Amino-3-hydroxybutanoic acid Abbreviations: T, Thr Synonyms: none |
||||||||||||||||
| Database data | ||||||||||||||||
| SMILES: CC(O)C(N)C(=O)O InChI=1/C4H9NO3/c1-2(6)3(5)4(7)8/h2-3,6H,5H2,1H3,(H,7,8)/t2-,3+/m1/s1/f/h7H
|
||||||||||||||||
| Physical properties | ||||||||||||||||
|
||||||||||||||||
| Hazard properties | ||||||||||||||||
|
||||||||||||||||
| Chemical properties | ||||||||||||||||
|
||||||||||||||||
| Pharmacological properties | ||||||||||||||||
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) | ||||||||||||||||
[edit] References
- a EINECS number 200-774-1 (Threonine)
- a CID 69435 from PubChem (D-Threonine)
- a CID 6288 from PubChem (L-Threonine)
|
||||||||

