Fenamic acid
From Wikipedia, the free encyclopedia
| Fenamic acid | |
|---|---|
 |
|
| IUPAC name | 2-(phenylamino)benzoic acid |
| Other names | N-phenylanthranilic acid |
| Identifiers | |
| CAS number | |
| PubChem | |
| SMILES | C1=CC=C(C=C1)NC2=CC=CC=C2C(=O)O |
| Properties | |
| Molecular formula | C13H11NO2 |
| Molar mass | 213.23194 |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
Fenamic acid is a molecule which serves as a parent structure for several non-steroidal anti-inflammatory drugs, including mefenamic acid, tolfenamic acid, flufenamic acid, and meclofenamic acid.
[edit] References
 |
This biochemistry article is a stub. You can help Wikipedia by expanding it. |
|
|||||||||||||||||||||||||||||||||||
