Homovanillic acid
From Wikipedia, the free encyclopedia
| Homovanillic acid | |
|---|---|
| IUPAC name | 2-(4-Hydroxy-3-methoxy-phenyl)acetic acid |
| Identifiers | |
| CAS number | [306-08-1] |
| PubChem | |
| MeSH | |
| SMILES | COC1=C(C=CC(=C1)CC(=O)O)O |
| Properties | |
| Molecular formula | C9H10O4 |
| Molar mass | 182.173 |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
Homovanillic acid (HOC6H3(OCH3)CH2COOH; synonyms: 3-Methoxy-4-hydroxyphenyl acetic acid; HVA; 4-Hydroxy-3-methoxy-benzeneacetic acid; 4-Hydroxy-3-methoxyphenylacetic acid) is a major catecholamine metabolite. It is used as a reagent to detect oxidative enzymes.
In psychiatry and neuroscience, brain and cerebrospinal fluid levels of HVA are measured as a marker of metabolic stress caused by 2-deoxy-D-glucose.[1]
[edit] References
- ^ Marcelis M, Suckling J, Hofman P, Woodruff P, Bullmore E, van Os J (September 2006). "Evidence that brain tissue volumes are associated with HVA reactivity to metabolic stress in schizophrenia". Schizophr. Res. 86 (1-3): 45–53. doi:. PMID 16806836.
|
|||||||||||||||||

