Normelatonin
From Wikipedia, the free encyclopedia
| Normelatonin | |
|---|---|
| IUPAC name | N-[2-(5-hydroxy-1H-indol-3-yl) ethyl]acetamide |
| Identifiers | |
| CAS number | [1210-83-9] |
| PubChem | |
| MeSH | |
| SMILES | CC(=O)NCCC1=CNC2=C1C=C(C=C2)O |
| Properties | |
| Molecular formula | C12H14N2O2 |
| Molar mass | 218.252 g/mol |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
Normelatonin also called N-acetylserotonin, is an intermediate in the production of melatonin from serotonin.
|
|||||
|
|||||||||||||||||

