Phosphoribosylamine
From Wikipedia, the free encyclopedia
| Phosphoribosylamine | |
|---|---|
| Identifiers | |
| CAS number | [14050-66-9] |
| PubChem | |
| MeSH | |
| SMILES | C(C1C(C(C(O1)N)O)O)OP(=O)(O)O |
| Properties | |
| Molecular formula | C5H12NO7P |
| Molar mass | 229.125 g/mol |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
Phosphoribosylamine (5PRA) is an intermediate in purine metabolism. It is a precursor to IMP. It is generated from Phosphoribosyl pyrophosphate (PRPP).
[edit] See also
|
|||||||||||||||||||||

