SAICAR
From Wikipedia, the free encyclopedia
| SAICAR | |
|---|---|
| Identifiers | |
| CAS number | [3031-95-6] |
| PubChem | |
| MeSH | |
| SMILES | C1=NC(=C(N1C2C(C(C(O2)COP(=O)(O)O)O)O)N) C(=O)NC(CC(=O)O)C(=O)O |
| Properties | |
| Molecular formula | C13H19N4O12P |
| Molar mass | 454.283321 |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
SAICAR is an intermediate in the formation of purines.
|
|||||||||||||||||||||

