Phosphomevalonic acid
From Wikipedia, the free encyclopedia
| Phosphomevalonic acid | |
|---|---|
 |
|
| IUPAC name | 3-hydroxy-3-methyl- 5-phosphonooxy-pentanoic acid |
| Identifiers | |
| CAS number | [1189-94-2] |
| PubChem | |
| MeSH | |
| SMILES | CC(CCOP(=O)(O)O)(CC(=O)O)O |
| Properties | |
| Molecular formula | C6H13O7P |
| Molar mass | 228.137 g/mol |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
Phosphomevalonic acid is an intermediate in the Mevalonate pathway.
 |
This biochemistry article is a stub. You can help Wikipedia by expanding it. |
|
|||||||||||||||||
