Dimethylallyl pyrophosphate
From Wikipedia, the free encyclopedia
| Dimethylallyl pyrophosphate | |
|---|---|
| IUPAC name | (hydroxy-(3-methylbut-2-enoxy) phosphoryl) oxyphosphonic acid |
| Identifiers | |
| CAS number | [358-72-5] |
| PubChem | |
| MeSH | |
| SMILES | CC(=CCOP(=O)(O)OP(=O)(O)O)C |
| Properties | |
| Molecular formula | C5H12O7P2 |
| Molar mass | 246.092 |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
Dimethylallyl pyrophosphate (or -diphosphate) (DMAPP) is an intermediate product of both mevalonic acid (MVA) pathway and DOXP/MEP pathway. It is an isomer of isopentenyl pyrophosphate (IPP) and exists in virtually all life forms.
Precursor of DMAPP in the MVA pathway is mevalonic acid, and 2-C-methyl-D-erythritol-e-P in the MEP/DOXP pathway.
At present, it is believed that there is crossover between the two pathways in organisms that use both pathways to create terpenes and terpenoids, such as in plants, and that DMAPP is the crossover product.
Simplified version of the steroid synthesis pathway with the intermediates isopentenyl pyrophosphate (IPP), dimethylallyl pyrophosphate (DMAPP), geranyl pyrophosphate (GPP) and squalene shown. Some intermediates are omitted.
[edit] External links
|
|||||||||||||||||

