Methyl-DOB
From Wikipedia, the free encyclopedia
| Methyl-DOB | |
|---|---|
| IUPAC name | 1-(4-bromo-2,5-dimethoxyphenyl)-N-methylpropan-2-amine |
| Identifiers | |
| CAS number | |
| SMILES | C1(=CC(=C(C=C1CC(C)NC)OC)Br)OC |
| Properties | |
| Molecular formula | C12H18BrNO2 |
| Molar mass | 288.181 g/mol |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
Methyl-DOB, or 4-bromo-2,5-dimethoxymethamphetamine, is a lesser-known psychedelic drug. It is similar in structure to DOB. Methyl-DOB was first synthesized by Alexander Shulgin. In his book PiHKAL (Phenethylamines i Have Known And Loved), the minimum dosage is listed as 8mg, and the duration unknown. Methyl-DOB produces many physical effects, such as mydriasis and muscle tenseness, but few psychoactive effects. Very little data exists about the pharmacological properties, metabolism, and toxicity of Methyl-DOB.

