Meta-DOT
From Wikipedia, the free encyclopedia
| Meta-DOT | |
|---|---|
| IUPAC name | 1-[2,4-dimethoxy-5-(methylsulfanyl)phenyl]propan-2-amine |
| Identifiers | |
| CAS number | |
| SMILES | C1(=CC(=C(C=C1CC(C)N)SC)OC)OC |
| Properties | |
| Molecular formula | C12H19NO2S |
| Molar mass | 241.350 g/mol |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
Meta-DOT, or 5-methylthio-2,4-dimethoxyamphetamine, is a lesser-known psychedelic drug. It is similar in structure to TMA-2. Meta-DOT was first synthesized by Alexander Shulgin. In his book PiHKAL (Phenethylamines i Have Known And Loved), the minimum dosage is listed as 35mg, and the duration unknown. Meta-DOT produces few to no effects. Very little data exists about the pharmacological properties, metabolism, and toxicity of Meta-DOT.

