DOAM
From Wikipedia, the free encyclopedia
| DOAM | |
|---|---|
| IUPAC name | 2-(2,5-Dimethoxy-4-pentyl-phenyl)-1-methyl-ethylamine |
| Other names | 2,5-Dimethoxy-4-amyl-amphetamine; 2,5-Dimethoxy-4-amyl-1-ethyl-(alpha-methyl)amine |
| Identifiers | |
| Abbreviations | DOAM |
| CAS number | [63779-90-8] |
| SMILES | CCCCCC1=CC(OC)=C(CC(C)N)C=C1OC |
| Properties | |
| Molecular formula | C16H27NO2 |
| Molar mass | 265.39 |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
DOAM, or 2,5-dimethoxy-4-(n)-amylamphetamine, is a lesser-known psychedelic drug and a substituted Amphetamine. DOAM was first synthesized by Alexander Shulgin. In his book PiHKAL (Phenethylamines i Have Known And Loved), the minimum dosage is listed as 10mg, and the duration is unknown. DOAM produces a bare threshold and tenseness. Very little data exists about the pharmacological properties, metabolism, and toxicity of DOAM.

