Chlorquinaldol
From Wikipedia, the free encyclopedia
| Chlorquinaldol | |
|---|---|
 |
|
| IUPAC name | 5,7-dichloro-2-methyl-8-quinolinol |
| Identifiers | |
| CAS number | [72-80-0] |
| PubChem | |
| SMILES | CC1=NC2=C(C=C1)C(=CC(=C2O)Cl)Cl |
| Properties | |
| Molecular formula | C10H7Cl2NO |
| Molar mass | 228.074 |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
Chlorquinaldol is an antiseptic/disinfectant.
 |
This pharmacology-related article is a stub. You can help Wikipedia by expanding it. |
|
||||||||||||||||||||||||||||||||
|
||||||||||||||||||||||||||
