Dibrompropamidine
From Wikipedia, the free encyclopedia
| Dibrompropamidine | |
|---|---|
| IUPAC name | 3-bromo-4-[3-(2-bromo-4-carbamimidoylphenoxy)propoxy]benzamidine |
| Identifiers | |
| CAS number | [496-00-4] |
| PubChem | |
| SMILES | C1=CC(=C(C=C1C(=N)N)Br)OCCCOC2=C(C=C(C=C2)C(=N)N)Br |
| Properties | |
| Molecular formula | C17H18Br2N4O2 |
| Molar mass | 470.159 |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
Dibrompropamidine is an antiseptic and disinfectant.
As Dibrompropamidine isetionate it is used in eyedrops and ointment for the treatment of infections. In the UK, such preparations are sold under the brand names Brolene (Aventis Pharma) and Golden Eye (Typharm Ltd)
|
||||||||||||||||||||||||||||||||

