4-Maleylacetoacetate
From Wikipedia, the free encyclopedia
| 4-Maleylacetoacetate | |
|---|---|
| IUPAC name | (Z)-4,6-dioxooct-2-enedioic acid |
| Identifiers | |
| CAS number | [5698-52-2] |
| PubChem | |
| SMILES | C(C(=O)CC(=O)O)C(=O)C=CC(=O)O |
| Properties | |
| Molecular formula | C8H8O6 |
| Molar mass | 200.146 g/mol |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
4-Maleylacetoacetate is an intermediate in the metabolism of tyrosine.
[edit] See also
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||

