3-Hydroxyisobutyryl-CoA
From Wikipedia, the free encyclopedia
| 3-Hydroxyisobutyryl-CoA | |
|---|---|
| IUPAC name | S-[2-[3-[[4-[[[(2R,3S,4R,5R)-5-(6-Aminopurin-9-yl)-4-hydroxy-3-phosphonooxyoxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-hydroxyphosphoryl]oxy-2-hydroxy-3,3-dimethylbutanoyl]amino]propanoylamino]ethyl] 3-hydroxy-2-methylpropanethioate |
| Identifiers | |
| CAS number | |
| PubChem | |
| SMILES | CC(CO)C(=O)SCCNC(=O)CCNC(=O)C(C(C)(C)COP(=O)(O)OP(=O)(O)OC[C@@H]1[C@H]([C@H]([C@@H](O1)N2C=NC3=C2N=CN=C3N)O)OP(=O)(O)O)O |
| Properties | |
| Molecular formula | C25H42N7O18P3S |
| Molar mass | 853.62 g/mol |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
3-Hydroxyisobutyryl-CoA (or 3-hydroxy-2-methylpropanoyl-CoA) is an intermediate in the metabolism of valine.
[edit] See also
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||

