2-Amino-3-carboxymuconic semialdehyde
From Wikipedia, the free encyclopedia
| 2-Amino-3-carboxymuconic semialdehyde | |
|---|---|
| IUPAC name | (Z)-2-Amino-3-[(Z)-3-oxoprop-1-enyl]but-2-enedioic acid |
| Identifiers | |
| CAS number | |
| PubChem | |
| SMILES | C(=C/C(=C(\C(=O)O)/N)/C(=O)O)/C=O |
| Properties | |
| Molecular formula | C7H7NO5 |
| Molar mass | 185.13 g/mol |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
2-Amino-3-carboxymuconic semialdehyde is an intermediate in the metabolism of tryptophan.
|
|||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||

