Sorbose
From Wikipedia, the free encyclopedia
| Sorbose | |
|---|---|
| IUPAC name | (3S,4R,5S)-1,3,4,5,6-Pentahydroxyhexan-2-one |
| Other names | Sorbinose L-xylo-Hexulose |
| Identifiers | |
| CAS number | [87-79-6] |
| PubChem | |
| SMILES | C([C@@H]([C@H]([C@@H](C(=O)CO)O)O)O)O |
| Properties | |
| Molecular formula | C6H12O6 |
| Molar mass | 180.156 |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
Sorbose is a ketose belonging to the group of sugars known as monosaccharides. The commercial production of vitamin C (ascorbic acid) often begins with sorbose. L-Sorbose is the configuration of the naturally-occurring sugar.
|
||||||||||||||||||||||||||||||||||||||

