Fuculose
From Wikipedia, the free encyclopedia
| L-Fuculose | |
|---|---|
| IUPAC name | (3R,4S,5S)-2-(Hydroxymethyl)-5-methyltetrahydrofuran-2,3,4-triol |
| Other names | 6-Deoxy-L-tagatose |
| Identifiers | |
| CAS number | |
| PubChem | |
| SMILES | O[C@H]1[C@@H](O)C(O)(CO)O[C@H]1C |
| Properties | |
| Molecular formula | C6H12O5 |
| Molar mass | 164.16 |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
Fuculose is a hexose deoxy sugar.
[edit] See also
- Fucitol
- Fucose
- L-Fuculose-phosphate
- L-Fuculose kinase
[edit] References
|
||||||||||||||||||||||||||||||||||||||

