Pinosylvin
From Wikipedia, the free encyclopedia
| Pinosylvin | |
|---|---|
| IUPAC name | 5-[(E)-2-Phenylethenyl]benzene-1,3-diol |
| Other names | (E)-3,5-Stilbenediol trans-3,5-Dihydroxystilbene |
| Identifiers | |
| CAS number | |
| PubChem | |
| SMILES | C1=CC=C(C=C1)\C=C\C2=CC(=CC(=C2)O)O |
| Properties | |
| Molecular formula | C14H12O2 |
| Molar mass | 212.244 g/mol |
| Melting point |
153-155 °C |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
Pinosylvin is a pre-infectious stilbenoid toxin (i.e. synthesized prior to infection), contrary to phytoalexins which are synthesized during infection. It is present in the heartwood of Pinaceae. It is a fungitoxin protecting the wood from fungal infection.
|
|||||||||||||||||||||||||||||

