Deoxyguanosine monophosphate
From Wikipedia, the free encyclopedia
| Deoxyguanosine monophosphate | |
|---|---|
| Identifiers | |
| CAS number | |
| PubChem | |
| SMILES | C1C(C(OC1N2C=NC3=C2NC(=NC3=O)N)COP(=O)(O)O)O.N |
| Properties | |
| Molecular formula | C10H17N6O7P |
| Molar mass | 364.251741 |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
Deoxyguanosine monophosphate is a derivative of the common nucleic acid GTP, or guanosine triphosphate, in which the -OH (hydroxyl) group on the 2' carbon on the nucleotide's pentose has been reduced to just a hydrogen atom (hence the deoxy- part of the name). The diphosphate of the name indicates that one of the phosphoryl groups of GTP have been removed, most likely by hydrolysis. Deoxyguanosine monophosphate would be abbreviated dGMP.
[edit] See also
- Nucleic acid,
- DNA metabolism,
- Cofactor,
- Guanosine
|
||||||||||||||

