Deoxycytidine diphosphate
From Wikipedia, the free encyclopedia
| Deoxycytidine diphosphate | |
|---|---|
| Identifiers | |
| CAS number | [800-73-7] |
| PubChem | |
| MeSH | |
| SMILES | Nc1ccn(C2CC(O)C(COP(=O)(O)OP(=O)(O)O)O2)c(=O)n1 |
| Properties | |
| Molecular formula | C9H15N3O10P2 |
| Molar mass | 387.177 |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
Deoxycytidine diphosphate is a derivative of the common nucleic acid, cytidine triphosphate or (CTP), in which the hydroxyl or (-OH) group on the 2nd carbon of the nucleotide's pentose has been removed -- hence the deoxy- part of the name. The diphosphate of the name indicates that one of the phosphoryl groups of CTP has been removed, most likely by hydrolysis.
Deoxyguanosine diphosphate would be abbreviated dCDP.
[edit] See also
|
||||||||||||||

