Cannabivarin
From Wikipedia, the free encyclopedia
| Cannabivarin | |
|---|---|
| IUPAC name | 6,6,9-trimethyl-3-propyl-1-benzo[c]chromenol |
| Identifiers | |
| CAS number | [33745-21-0] |
| PubChem | |
| MeSH | |
| SMILES | CCCC1=CC2=C(C(=C1)O)C3=C(C=CC(=C3)C)C(O2)(C)C |
| InChI | InChI=1/C19H22O2/c1-5-6-13-10-16(20)18-14-9-12(2)7-8-15(14)19(3,4)21-17(
18)11-13/h7-11,20H,5-6H2,1-4H3 |
| Properties | |
| Molecular formula | C19H22O2 |
| Molar mass | 282.38 |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
Cannabivarin, also known as cannabivarol or CBV, is a non-psychoactive cannabinoid found in minor amounts in the hemp plant Cannabis sativa. It is an analog of cannabinol (CBN) with the sidechain shortened by two CH2 groups. CBV is an oxidation product of tetrahydrocannabivarin (THCV, THV).
[edit] See also
[edit] External links
- Erowid Compounds found in Cannabis sativa
|
|||||||||||||||||||||||||||||||||||||

