Tiazofurin
From Wikipedia, the free encyclopedia
| Tiazofurin | |
|---|---|
| IUPAC name | 2-[(2R,3R,4S,5R)-3,4-Dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,3-thiazole-4-carboxamide |
| Identifiers | |
| CAS number | [60084-10-8] |
| PubChem | |
| MeSH | |
| SMILES | C1=C(N=C(S1)[C@H]2[C@@H]([C@@H]([C@H](O2)CO)O)O)C(=O)N |
| Properties | |
| Molecular formula | C9H12N2O5S |
| Molar mass | 260.268 |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
Tiazofurin is an inhibitor of IMP dehydrogenase. Tiazofurin and its analogues are under investigation for potential use in the treatment of cancer.[1]
[edit] References
- ^ Popsavin M, Torović L, Svircev M et al (2006). "Synthesis and antiproliferative activity of two new tiazofurin analogues with 2'-amido functionalities". Bioorg. Med. Chem. Lett. 16 (10): 2773–6. doi:. PMID 16495053.

