PyBOP
From Wikipedia, the free encyclopedia
| PyBOP | |
|---|---|
| IUPAC name | (Benzotriazol-1-yloxy)tripyrrolidinophosphonium hexafluorophosphate |
| Other names | PyBOP |
| Identifiers | |
| CAS number | [128625-52-5] |
| SMILES | c1cccc5c1nnn5O[P+](N2CCCC2)(N3CCCC3)N4CCCC4 |
| Properties | |
| Molecular formula | C18H28N6OP·PF6 |
| Molar mass | 520.39 g/mol |
| Appearance | White crystals |
| Melting point |
150 °C |
| Hazards | |
| Main hazards | Irritant |
| R-phrases | R36/37/38 |
| S-phrases | S26-36 |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
PyBOP is a tradename for the chemical benzotriazol-1-yl-oxytripyrrolidinophosphonium hexafluorophosphate, a peptide coupling reagent used in solid phase peptide synthesis.
[edit] See also
- BOP reagent (Benzotriazole-1-yl-oxy-tris-(dimethylamino)-phosphonium hexafluorophosphate)

