Hydroxylysine
From Wikipedia, the free encyclopedia
| Hydroxylysine | |
|---|---|
 |
|
| IUPAC name | (2S,5R)-2,6-Diamino-5-hydroxyhexanoic acid |
| Other names | 5-Hydroxy-L-lysine |
| Identifiers | |
| CAS number | [28902-93-4] |
| PubChem | |
| MeSH | |
| SMILES | C(C[C@@H](C(=O)O)N)[C@H](CN)O |
| Properties | |
| Molecular formula | C6H14N2O3 |
| Molar mass | 162.187 |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
5-Hydroxylysine is an amino acid with the molecular formula C6H14N2O3. It is a hydroxy derivative of lysine. It is most widely known as a component of collagen.[1]
It is biosynthesized from lysine via oxidation by the enzyme lysyl hydroxylase.
