Glucono delta-lactone
From Wikipedia, the free encyclopedia
| Glucono delta-lactone[1][2] | |
|---|---|
| IUPAC name | (3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydro-2H-pyran-2-one |
| Identifiers | |
| CAS number | [90-80-2] |
| PubChem | |
| SMILES | C(C1C(C(C(C(=O)O1)O)O)O)O |
| Properties | |
| Molecular formula | C6H10O6 |
| Molar mass | 178.14 g/mol |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
Glucono delta-lactone (GDL) is a naturally-occurring food additive used as a sequestrant, an acidifier, or a curing, pickling, or leavening agent. It is a cyclic ester of D-gluconic acid. Pure GDL is a white odorless crystalline powder.
GDL is commonly found in honey, fruit juices, and wine. Being acidic, it adds a tangy taste to foods, though it has roughly a third of the sourness of citric acid. It is metabolized to glucose; one gram of GDL is equivalent to one gram of sugar.
Glucono-delta-lactone, upon addition to water readily forms an equilibrium mixture of the lactone GDL and gluconic acid. The rate of hydrolysis of GDL is increased by heat and high pH.[3]

