Fuchsine acid
From Wikipedia, the free encyclopedia
| Fuchsine acid | |
|---|---|
 |
|
| Identifiers | |
| CAS number | [3244-88-0] |
| SMILES | Cc1cc(cc(OS(=O)O[Na])c1N)C (c2ccc(N)c(OS(=O)O[Na])c2)=C3 C=CC(=[NH2+])C(=C3)OS([O-])=O |
| Properties | |
| Molecular formula | C20H17N3Na2O9S3 |
| Molar mass | 585.538 g/mol |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
 |
This article about an organic compound is a stub. You can help Wikipedia by expanding it. |
Fuchsine acid is an acidic magenta dye with chemical formula C20H17N3Na2O9S3.
