Fructose-1-phosphate
From Wikipedia, the free encyclopedia
| Fructose-1-phosphate | |
|---|---|
| IUPAC name | [2,3,4-Trihydroxy-5-(hydroxymethyl)oxolan-2-yl]methoxyphosphonic acid |
| Identifiers | |
| CAS number | [15978-08-2] |
| PubChem | |
| MeSH | |
| SMILES | C(C1C(C(C(O1)(COP(=O)(O)O)O)O)O)O |
| Properties | |
| Molecular formula | C6H13O9P |
| Molar mass | 260.136 |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
Fructose-1-phosphate is a derivative of fructose. It is generated by hepatic fructokinase.
It is converted by aldolase B into glyceraldehyde and dihydroxyacetone phosphate (DHAP).

