alpha-Cyano-4-hydroxycinnamic acid
From Wikipedia, the free encyclopedia
| α-Cyano-4-hydroxycinnamic acid | |
|---|---|
 |
|
| IUPAC name | (E)-2-cyano-3-(4-hydroxyphenyl)prop-2-enoate |
| Other names | alpha-cyano-4-hydroxycinnamic acid alpha-cyano-4-hydroxycinnamate 2-cyano-4-hydroxycinnamate |
| Identifiers | |
| CAS number | [28166-41-8] |
| PubChem | |
| SMILES | C1=CC(=CC=C1C=C(C#N)C(=O)[O-])O |
| Properties | |
| Molecular formula | C10H6NO3- |
| Molar mass | 188.16 |
| Appearance | Yellow powder |
| Melting point |
245-250 °C |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
α-Cyano-4-hydroxycinnamic acid, also written as alpha-cyano-4-hydroxycinnamic acid, is a cinnamic acid derivative and is a member of the phenylpropanoid family. It is used as a matrix for peptides and nucleotides in MALDI mass spectroscopy analyses.
[edit] Sources
[edit] See also
 |
This article about an organic compound is a stub. You can help Wikipedia by expanding it. |
