Adosterol
From Wikipedia, the free encyclopedia
| Adosterol | |
|---|---|
 |
|
| IUPAC name | (3S,6S,8S,9S,13R,14S,17R)-6-(iodomethyl)- 13-methyl-17-(6-methylheptan-2-yl)-1,2,3,4, 6,7,8,9,11,12,14,15,16,17-tetradecahydro cyclopenta[a]phenanthren-3-ol |
| Identifiers | |
| CAS number | [55623-03-5] |
| PubChem | |
| MeSH | |
| SMILES | CC(C)CCCC(C)[C@H]1CC[C@H]2[C@@H]3C[C@@H] (CI)C4=C(CC[C@H](O)C4)[C@H]3CC[C@]12C |
| Properties | |
| Molecular formula | C27H45IO |
| Molar mass | 512.55 g/mol |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
Adosterol is an iodine-containing sterol.
 |
This article about an organic compound is a stub. You can help Wikipedia by expanding it. |
|
|||||
