5-Methyltetrahydrofolate
From Wikipedia, the free encyclopedia
| 5-Methyltetrahydrofolate | |
|---|---|
 |
|
| IUPAC name | (2S)-2-[ [4-[(2-Amino-5-methyl-4-oxo-1,6,7,8-tetrahydropteridin-6-yl)methylamino]benzoyl]amino]pentanedioic acid |
| Other names | 5-Methyltetrahydrofolic acid |
| Identifiers | |
| CAS number | [134-35-0] |
| PubChem | |
| MeSH | |
| SMILES | CN1C(CNC2=C1C(=O)N=C(N2)N)CNC3=CC=C(C=C3)C(=O)N[C@@H](CCC(=O)O)C(=O)O |
| Properties | |
| Molecular formula | C20H25N7O6 |
| Molar mass | 459.46 g/mol |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
5-Methyltetrahydrofolate, or 5-methyltetrahydrofolic acid, is a methylated derivate of tetrahydrofolate. It is generated by methylenetetrahydrofolate reductase from 5,10-methylenetetrahydrofolate and used to recycle homocysteine back to methionine by 5-methyltetrahydrofolate-homocysteine methyltransferases (also called methionine synthases).
[edit] See also
- 5-Methyltetrahydrofolate-homocysteine methyltransferase
- S-Adenosyl methionine
- Methylenetetrahydrofolate reductase
- 5,10-Methylenetetrahydrofolate
 |
This biochemistry article is a stub. You can help Wikipedia by expanding it. |
