β-Santalol
From Wikipedia, the free encyclopedia
| β-Santalol | |
|---|---|
| IUPAC name | (2Z)-2-methyl-5-[2-methyl-3-methylene bicyclo[2.2.1]hept-2-yl]pent-2-en-1-ol |
| Identifiers | |
| CAS number | [77-42-9] |
| EINECS number | |
| SMILES | C/C(CO)=C\CCC2(C)C(=C)C1CC2CC1 |
| Properties | |
| Molecular formula | C15H24O |
| Molar mass | 220.34 |
| Appearance | Liquid |
| Density | 0.9717 |
| Boiling point |
177 °C, 450 K, 351 °F |
| Solubility in water | practically insoluble |
| Solubility in ethanol | soluble |
| Solubility in diethyl ether | soluble |
| Chiral rotation [α]D | −87.1° |
| Refractive index (nD) | 1.5100 |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
β-Santanol is an organic chemical compound and is a principal constituent of oil of sandalwood.

