α-Santalol
From Wikipedia, the free encyclopedia
| α-Santalol | |
|---|---|
 |
|
 |
|
| IUPAC name | 5-(2,3-Dimethyltricyclol[2.2.1.02,6]hept-3-yl)- 2-methylpent-2-en-1-ol |
| Identifiers | |
| CAS number | [115-71-9] |
| EINECS number | |
| SMILES | C/C(C)=C\CCC2(C)C(=C)C1CC2CC1 |
| Properties | |
| Molecular formula | C15266O |
| Molar mass | 220.34 |
| Appearance | Liquid |
| Density | 0.9770 |
| Boiling point |
166 °C, 439 K, 331 °F |
| Solubility in water | practically insoluble |
| Solubility in ethanol | soluble |
| Solubility in diethyl ether | soluble |
| Chiral rotation [α]D | +10.3° |
| Refractive index (nD) | 1.5017 |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
α-Santalol is an organic chemical compound and is a principal constituent of oil of sandalwood. It is part of the larger group of Sesquiterpenes. One cyclopropane ring is also part of the structure of α-Santalol.
[edit] See also
 |
This article about an alcohol is a stub. You can help Wikipedia by expanding it. |
