Xanthurenic acid
From Wikipedia, the free encyclopedia
| Xanthurenic acid[1] | |
|---|---|
| IUPAC name | 8-Hydroxy-4-oxo-1H-quinoline-2-carboxylic acid |
| Other names | Xanthuric acid Xanthurenate 8-Hydroxykynurenic acid 4,8-Dihydroxyquinaldic acid |
| Identifiers | |
| CAS number | [59-00-7] |
| PubChem | |
| SMILES | OC2=CC(C(O)=O)=NC1=C(O)C=CC=C12 |
| Properties | |
| Molecular formula | C10H7NO4 |
| Molar mass | 205.17 g/mol |
| Appearance | Yellow crystals |
| Melting point |
286 °C, 559 K, 547 °F |
| Solubility in water | Insoluble |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
Xanthurenic acid is a chemical shown to induce gametogenesis of Plasmodium falciparum, the parasite that causes malaria.[2] It is found in the gut of the Anopheles mosquito.
Xanthurenic acid is a metabolic intermediate that accumulates and is excreted by pyridoxine (vitamin B6) deficient animals after the ingestion of tryptophan.[1][3]
[edit] See also
[edit] References
- ^ a b Merck Index, 11th Edition, 9977.
- ^ Billker (March 19, 1998). "Identification of xanthurenic acid as the putative inducer of malaria development in the mosquito". Nature 392: 289-292.
- ^ Xanthurenic acid at Sigma-Aldrich

