Tyropanoic acid
From Wikipedia, the free encyclopedia
| Tyropanoic acid | |
|---|---|
 |
|
| IUPAC name | 2-[ [2,4,6-triiodo-3-(1-oxobutylamino)phenyl]methyl]butanoic acid |
| Identifiers | |
| CAS number | |
| PubChem | |
| SMILES | CCCC(=O)NC1=C(C=C(C(=C1I)CC(CC)C(=O)O)I)I |
| Properties | |
| Molecular formula | C15H18I3NO3 |
| Molar mass | 641.02173 |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
Tyropanoic acid and its salt sodium tyropanoate are radiopaque contrast media used in cholecystography (X-ray diagnosis of gallstones). Trade names include Bilopaque, Lumopaque, Tyropaque, and Bilopac.[1] The molecule contains three heavy iodine atoms which obstruct X-rays in the same way as the calcium in bones to produce a visible image. After injection it is rapidly excreted into the bile.[2]
[edit] References
 |
This pharmacology-related article is a stub. You can help Wikipedia by expanding it. |
 |
This article about an organic halide is a stub. You can help Wikipedia by expanding it. |
