Trinitrotriazine
From Wikipedia, the free encyclopedia
| Trinitrotriazine | |
|---|---|
 |
|
| IUPAC name | 2,4,6-Trinitro-1,3,5-triazine |
| Identifiers | |
| CAS number | [140218-59-3] |
| SMILES | O=[N+]([O-])C1=NC([N+]([O-])=O)=NC([N+]([O-])=O)=N1 |
| Properties | |
| Molecular formula | C3N3O6 |
| Molar mass | 216.07 |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
Trinitrotriazine, or 2,4,6-trinitro-1,3,5-triazine, is a potential explosive. It can be made by reacting triazine with nitric acid and a sulfuric acid catalyst:
- C3H3N3 + 3 HNO3 → C3N3(NO2)3 + 3 H2O
It may explode without the addition of oxygen or any other reactant:
- C3N3(NO2)3 → 3 CO2 + 3 N2
 |
This explosives-related article is a stub. You can help by expanding it. |
