Trimesic acid
From Wikipedia, the free encyclopedia
| Trimesic acid | |
|---|---|
 |
|
| IUPAC name | benzene-1,3,5-tricarboxylic acid |
| Identifiers | |
| CAS number | [554-95-0] |
| PubChem | |
| EINECS number | |
| SMILES | C1=C(C=C(C=C1C(=O)O)C(=O)O)C(=O)O |
| Properties | |
| Molecular formula | C9H6O6 |
| Molar mass | 210.14034 |
| Hazards | |
| MSDS | Oxford MSDS |
| R-phrases | R36 R37 R38 |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
Trimesic acid, formally known as benzene-1,3,5-tricarboxylic acid, is a benzene derivative with three carboxylic acid groups.
 |
This article about an organic compound is a stub. You can help Wikipedia by expanding it. |
