Theaflavin digallate
From Wikipedia, the free encyclopedia
| Theaflavin digallate | |
|---|---|
| IUPAC name | [1-[(2R,3R)-3,5-dihydroxy-7-(3,4,5-trihydroxybenzoyl)oxychroman-2-yl]-3,5-dihydroxy-6-oxo-8-[(3R)-3,5,7-trihydroxychroman-2-yl]benzo[7]annulen-4-yl] 3,4,5-trihydroxybenzoate |
| Identifiers | |
| CAS number | [33377-72-9] |
| PubChem | |
| SMILES | C1[C@H](C(OC2=CC(=CC(=C21)O)O)C3=CC(=O)C(=C4C(=C3)C(=CC(=C4OC(=O)C5=CC(=C(C(=C5)O)O)O)O)[C@@H]6[C@@H](CC7=C(C=C(C=C7O6)OC(=O)C8=CC(=C(C(=C8)O)O)O)O)O)O)O |
| Properties | |
| Molecular formula | C43H32O20 |
| Molar mass | 868.702 |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
Theaflavin digallate is a theaflavin derivative.

